C25H23ClN3O3+ — CID 59943172
N-(2-chloro-5-methylphenyl)-3-(4-methoxyphenyl)-2-(4-methyl-3H-benzimidazol-1-ium-1-yl)-3-oxopropanamide (PubChem CID 59943172) has the molecular formula C25H23ClN3O3+ and a molecular weight of 448.93 g/mol. Its IUPAC name is N-(2-chloro-5-methylphenyl)-3-(4-methoxyphenyl)-2-(4-methyl-3H-benzimidazol-1-ium-1-yl)-3-oxopropanamide.
| Compound Name | N-(2-chloro-5-methylphenyl)-3-(4-methoxyphenyl)-2-(4-methyl-3H-benzimidazol-1-ium-1-yl)-3-oxopropanamide |
|---|---|
| PubChem CID | 59943172 |
| Molecular Formula | C25H23ClN3O3+ |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(2-chloro-5-methylphenyl)-3-(4-methoxyphenyl)-2-(4-methyl-3H-benzimidazol-1-ium-1-yl)-3-oxopropanamide |
| SMILES | COc1ccc(C(=O)C(C(=O)Nc2cc(C)ccc2Cl)[n+]2c[nH]c3c(C)cccc32)cc1 |
| InChI | InChI=1S/C25H22ClN3O3/c1-15-7-12-19(26)20(13-15)28-25(31)23(24(30)17-8-10-18(32-3)11-9-17)29-14-27-22-16(2)5-4-6-21(22)29/h4-14,23H,1-3H3,(H,28,31)/p+1 |
| InChIKey | IXBYQFYOPYVLSD-UHFFFAOYSA-O |
| XLogP | 4.80 |
| TPSA | 75.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|