C22H22ClNO5S — CID 59899955
ethyl 3-[1-(2-chloro-5-methylanilino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]sulfanylprop-2-enoate (PubChem CID 59899955) has the molecular formula C22H22ClNO5S and a molecular weight of 447.94 g/mol. Its IUPAC name is ethyl 3-[1-(2-chloro-5-methylanilino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]sulfanylprop-2-enoate.
| Compound Name | ethyl 3-[1-(2-chloro-5-methylanilino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]sulfanylprop-2-enoate |
|---|---|
| PubChem CID | 59899955 |
| Molecular Formula | C22H22ClNO5S |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | ethyl 3-[1-(2-chloro-5-methylanilino)-3-(4-methoxyphenyl)-1,3-dioxopropan-2-yl]sulfanylprop-2-enoate |
| SMILES | CCOC(=O)C=CSC(C(=O)Nc1cc(C)ccc1Cl)C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H22ClNO5S/c1-4-29-19(25)11-12-30-21(20(26)15-6-8-16(28-3)9-7-15)22(27)24-18-13-14(2)5-10-17(18)23/h5-13,21H,4H2,1-3H3,(H,24,27) |
| InChIKey | FKNRAAHCCDXZSB-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|