C22H22Cl2N2O6 — CID 20719550
ethyl 4-chloro-3-[[3-(2-chloro-5-ethoxycarbonylanilino)-2-methyl-3-oxopropanoyl]amino]benzoate (PubChem CID 20719550) has the molecular formula C22H22Cl2N2O6 and a molecular weight of 481.33 g/mol. Its IUPAC name is ethyl 4-chloro-3-[[3-(2-chloro-5-ethoxycarbonylanilino)-2-methyl-3-oxopropanoyl]amino]benzoate.
| Compound Name | ethyl 4-chloro-3-[[3-(2-chloro-5-ethoxycarbonylanilino)-2-methyl-3-oxopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 20719550 |
| Molecular Formula | C22H22Cl2N2O6 |
| Molecular Weight | 481.33 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | ethyl 4-chloro-3-[[3-(2-chloro-5-ethoxycarbonylanilino)-2-methyl-3-oxopropanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(Cl)c(NC(=O)C(C)C(=O)Nc2cc(C(=O)OCC)ccc2Cl)c1 |
| InChI | InChI=1S/C22H22Cl2N2O6/c1-4-31-21(29)13-6-8-15(23)17(10-13)25-19(27)12(3)20(28)26-18-11-14(7-9-16(18)24)22(30)32-5-2/h6-12H,4-5H2,1-3H3,(H,25,27)(H,26,28) |
| InChIKey | SIFDPJYLJCMVEH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.33 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|