C21H22ClNO4 — CID 5258804
3-methylbutyl 4-chloro-3-[(3-oxo-3-phenylpropanoyl)amino]benzoate (PubChem CID 5258804) has the molecular formula C21H22ClNO4 and a molecular weight of 387.86 g/mol. Its IUPAC name is 3-methylbutyl 4-chloro-3-[(3-oxo-3-phenylpropanoyl)amino]benzoate.
| Compound Name | 3-methylbutyl 4-chloro-3-[(3-oxo-3-phenylpropanoyl)amino]benzoate |
|---|---|
| PubChem CID | 5258804 |
| Molecular Formula | C21H22ClNO4 |
| Molecular Weight | 387.86 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | 3-methylbutyl 4-chloro-3-[(3-oxo-3-phenylpropanoyl)amino]benzoate |
| SMILES | CC(C)CCOC(=O)c1ccc(Cl)c(NC(=O)CC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H22ClNO4/c1-14(2)10-11-27-21(26)16-8-9-17(22)18(12-16)23-20(25)13-19(24)15-6-4-3-5-7-15/h3-9,12,14H,10-11,13H2,1-2H3,(H,23,25) |
| InChIKey | BMOLPINATFNCGA-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|