C25H24ClNO3 — CID 7312050
propyl 4-chloro-3-(3,3-diphenylpropanoylamino)benzoate (PubChem CID 7312050) has the molecular formula C25H24ClNO3 and a molecular weight of 421.92 g/mol. Its IUPAC name is propyl 4-chloro-3-(3,3-diphenylpropanoylamino)benzoate.
| Compound Name | propyl 4-chloro-3-(3,3-diphenylpropanoylamino)benzoate |
|---|---|
| PubChem CID | 7312050 |
| Molecular Formula | C25H24ClNO3 |
| Molecular Weight | 421.92 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | propyl 4-chloro-3-(3,3-diphenylpropanoylamino)benzoate |
| SMILES | CCCOC(=O)c1ccc(Cl)c(NC(=O)CC(c2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C25H24ClNO3/c1-2-15-30-25(29)20-13-14-22(26)23(16-20)27-24(28)17-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-14,16,21H,2,15,17H2,1H3,(H,27,28) |
| InChIKey | MPWCNKHMMFCOCZ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.92 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |