actinium;2-hydroxy-2-(methylamino)acetic acid

C3H7AcNO3 — CID 59943619

IUPACactinium;2-hydroxy-2-(methylamino)acetic acid
SMILESCNC(O)C(=O)O.[Ac]
InChIInChI=1S/C3H7NO3.Ac/c1-4-2(5)3(6)7;/h2,4-5H,1H3,(H,6,7);
InChIKeyQZAOCGNRJMEDKM-UHFFFAOYSA-N
MW332.09 g/mol
LogP-1.39
Rot. Bonds2

About actinium;2-hydroxy-2-(methylamino)acetic acid

actinium;2-hydroxy-2-(methylamino)acetic acid (PubChem CID 59943619) has the molecular formula C3H7AcNO3 and a molecular weight of 332.09 g/mol. Its IUPAC name is actinium;2-hydroxy-2-(methylamino)acetic acid.

Molecular Properties

Compound Nameactinium;2-hydroxy-2-(methylamino)acetic acid
PubChem CID59943619
Molecular FormulaC3H7AcNO3
Molecular Weight332.09 g/mol
Exact Mass332.07
IUPAC Nameactinium;2-hydroxy-2-(methylamino)acetic acid
SMILESCNC(O)C(=O)O.[Ac]
InChIInChI=1S/C3H7NO3.Ac/c1-4-2(5)3(6)7;/h2,4-5H,1H3,(H,6,7);
InChIKeyQZAOCGNRJMEDKM-UHFFFAOYSA-N
XLogP-1.39
TPSA69.56 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms8
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500332.09
LogP ≤ 5-1.39
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze actinium;2-hydroxy-2-(methylamino)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of actinium;2-hydroxy-2-(methylamino)acetic acid?
The IUPAC name of actinium;2-hydroxy-2-(methylamino)acetic acid (CID 59943619) is actinium;2-hydroxy-2-(methylamino)acetic acid.
What is the SMILES notation for actinium;2-hydroxy-2-(methylamino)acetic acid?
The canonical SMILES for actinium;2-hydroxy-2-(methylamino)acetic acid is CNC(O)C(=O)O.[Ac].
What is the InChIKey of actinium;2-hydroxy-2-(methylamino)acetic acid?
The InChIKey is QZAOCGNRJMEDKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO3.Ac/c1-4-2(5)3(6)7;/h2,4-5H,1H3,(H,6,7);.
What are the key properties of actinium;2-hydroxy-2-(methylamino)acetic acid?
actinium;2-hydroxy-2-(methylamino)acetic acid has a molecular weight of 332.09 g/mol, XLogP of -1.39, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;2-hydroxy-2-(methylamino)acetic acid is sourced from PubChem (CID 59943619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).