C18H28O5 — CID 59950291
[2-(2,5-dimethyl-4-oxohex-5-en-2-yl)-5-methyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate (PubChem CID 59950291) has the molecular formula C18H28O5 and a molecular weight of 324.42 g/mol. Its IUPAC name is [2-(2,5-dimethyl-4-oxohex-5-en-2-yl)-5-methyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate.
| Compound Name | [2-(2,5-dimethyl-4-oxohex-5-en-2-yl)-5-methyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59950291 |
| Molecular Formula | C18H28O5 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | [2-(2,5-dimethyl-4-oxohex-5-en-2-yl)-5-methyl-1,3-dioxan-5-yl]methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)CC(C)(C)C1OCC(C)(COC(=O)C(=C)C)CO1 |
| InChI | InChI=1S/C18H28O5/c1-12(2)14(19)8-17(5,6)16-22-10-18(7,11-23-16)9-21-15(20)13(3)4/h16H,1,3,8-11H2,2,4-7H3 |
| InChIKey | ALYPONJKIPNZLS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|