C40H44N6O7S — CID 59951201
(2S)-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]-2-[[4-[3-(4-prop-2-enoxycarbonylphenyl)indazol-1-yl]benzoyl]amino]hexanoic acid (PubChem CID 59951201) has the molecular formula C40H44N6O7S and a molecular weight of 752.89 g/mol. Its IUPAC name is (2S)-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]-2-[[4-[3-(4-prop-2-enoxycarbonylphenyl)indazol-1-yl]benzoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]-2-[[4-[3-(4-prop-2-enoxycarbonylphenyl)indazol-1-yl]benzoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 59951201 |
| Molecular Formula | C40H44N6O7S |
| Molecular Weight | 752.89 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | (2S)-6-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]-2-[[4-[3-(4-prop-2-enoxycarbonylphenyl)indazol-1-yl]benzoyl]amino]hexanoic acid |
| SMILES | C=CCOC(=O)c1ccc(-c2nn(-c3ccc(C(=O)N[C@@H](CCCCNC(=O)CCCCC4SCC5NC(=O)NC54)C(=O)O)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H44N6O7S/c1-2-23-53-39(51)27-16-14-25(15-17-27)35-29-9-3-4-11-32(29)46(45-35)28-20-18-26(19-21-28)37(48)42-30(38(49)50)10-7-8-22-41-34(47)13-6-5-12-33-36-31(24-54-33)43-40(52)44-36/h2-4,9,11,14-21,30-31,33,36H,1,5-8,10,12-13,22-24H2,(H,41,47)(H,42,48)(H,49,50)(H2,43,44,52)/t30-,31?,33?,36?/m0/s1 |
| InChIKey | MCJVYTFJAWQPHA-ABAJQZNPSA-N |
| XLogP | 5.23 |
| TPSA | 180.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|