C37H39N5O6S — CID 59951203
prop-2-enyl 4-[1-[4-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxycarbonyl]phenyl]indazol-3-yl]benzoate (PubChem CID 59951203) has the molecular formula C37H39N5O6S and a molecular weight of 681.82 g/mol. Its IUPAC name is prop-2-enyl 4-[1-[4-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxycarbonyl]phenyl]indazol-3-yl]benzoate.
| Compound Name | prop-2-enyl 4-[1-[4-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxycarbonyl]phenyl]indazol-3-yl]benzoate |
|---|---|
| PubChem CID | 59951203 |
| Molecular Formula | C37H39N5O6S |
| Molecular Weight | 681.82 g/mol |
| Exact Mass | 681.26 |
| IUPAC Name | prop-2-enyl 4-[1-[4-[3-[5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanoylamino]propoxycarbonyl]phenyl]indazol-3-yl]benzoate |
| SMILES | C=CCOC(=O)c1ccc(-c2nn(-c3ccc(C(=O)OCCCNC(=O)CCCCC4SCC5NC(=O)NC54)cc3)c3ccccc23)cc1 |
| InChI | InChI=1S/C37H39N5O6S/c1-2-21-47-35(44)25-14-12-24(13-15-25)33-28-8-3-4-9-30(28)42(41-33)27-18-16-26(17-19-27)36(45)48-22-7-20-38-32(43)11-6-5-10-31-34-29(23-49-31)39-37(46)40-34/h2-4,8-9,12-19,29,31,34H,1,5-7,10-11,20-23H2,(H,38,43)(H2,39,40,46) |
| InChIKey | DIGXORKUZQCJLS-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.82 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|