C19H15N3O4S — CID 59951292
4,11-diamino-2-(2-methoxyethyl)-3-sulfanylidenenaphtho[3,2-f]isoindole-1,5,10-trione (PubChem CID 59951292) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 4,11-diamino-2-(2-methoxyethyl)-3-sulfanylidenenaphtho[3,2-f]isoindole-1,5,10-trione.
| Compound Name | 4,11-diamino-2-(2-methoxyethyl)-3-sulfanylidenenaphtho[3,2-f]isoindole-1,5,10-trione |
|---|---|
| PubChem CID | 59951292 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4,11-diamino-2-(2-methoxyethyl)-3-sulfanylidenenaphtho[3,2-f]isoindole-1,5,10-trione |
| SMILES | COCCn1c(=O)c2c(N)c3c(=O)c4ccccc4c(=O)c3c(N)c2c1=S |
| InChI | InChI=1S/C19H15N3O4S/c1-26-7-6-22-18(25)12-13(19(22)27)15(21)11-10(14(12)20)16(23)8-4-2-3-5-9(8)17(11)24/h2-5H,6-7,20-21H2,1H3 |
| InChIKey | DPWKROOSMGAFSS-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 117.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|