C27H31N3O5 — CID 57086679
4,11-diamino-2-(3-octan-3-yloxypropyl)naphtho[2,3-f]isoindole-1,3,5,10-tetrone (PubChem CID 57086679) has the molecular formula C27H31N3O5 and a molecular weight of 477.56 g/mol. Its IUPAC name is 4,11-diamino-2-(3-octan-3-yloxypropyl)naphtho[2,3-f]isoindole-1,3,5,10-tetrone.
| Compound Name | 4,11-diamino-2-(3-octan-3-yloxypropyl)naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
|---|---|
| PubChem CID | 57086679 |
| Molecular Formula | C27H31N3O5 |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 4,11-diamino-2-(3-octan-3-yloxypropyl)naphtho[2,3-f]isoindole-1,3,5,10-tetrone |
| SMILES | CCCCCC(CC)OCCCn1c(=O)c2c(N)c3c(=O)c4ccccc4c(=O)c3c(N)c2c1=O |
| InChI | InChI=1S/C27H31N3O5/c1-3-5-6-10-15(4-2)35-14-9-13-30-26(33)20-21(27(30)34)23(29)19-18(22(20)28)24(31)16-11-7-8-12-17(16)25(19)32/h7-8,11-12,15H,3-6,9-10,13-14,28-29H2,1-2H3 |
| InChIKey | ZWNVNCGNGNFWJM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 134.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|