C36H41N3O5 — CID 20717360
11-amino-2-[4-[butyl(decyl)amino]phenyl]-4-hydroxynaphtho[2,3-f]isoindole-1,3,5,10-tetrone (PubChem CID 20717360) has the molecular formula C36H41N3O5 and a molecular weight of 595.74 g/mol. Its IUPAC name is 11-amino-2-[4-[butyl(decyl)amino]phenyl]-4-hydroxynaphtho[2,3-f]isoindole-1,3,5,10-tetrone.
| Compound Name | 11-amino-2-[4-[butyl(decyl)amino]phenyl]-4-hydroxynaphtho[2,3-f]isoindole-1,3,5,10-tetrone |
|---|---|
| PubChem CID | 20717360 |
| Molecular Formula | C36H41N3O5 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.30 |
| IUPAC Name | 11-amino-2-[4-[butyl(decyl)amino]phenyl]-4-hydroxynaphtho[2,3-f]isoindole-1,3,5,10-tetrone |
| SMILES | CCCCCCCCCCN(CCCC)c1ccc(-n2c(=O)c3c(N)c4c(=O)c5ccccc5c(=O)c4c(O)c3c2=O)cc1 |
| InChI | InChI=1S/C36H41N3O5/c1-3-5-7-8-9-10-11-14-22-38(21-6-4-2)23-17-19-24(20-18-23)39-35(43)28-30(36(39)44)34(42)29-27(31(28)37)32(40)25-15-12-13-16-26(25)33(29)41/h12-13,15-20,42H,3-11,14,21-22,37H2,1-2H3 |
| InChIKey | HABDSYFTXJZAQW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 122.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|