C24H13N3O8 — CID 23517659
5-(4,11-diamino-1,3,5,10-tetraoxonaphtho[2,3-f]isoindol-2-yl)benzene-1,3-dicarboxylic acid (PubChem CID 23517659) has the molecular formula C24H13N3O8 and a molecular weight of 471.38 g/mol. Its IUPAC name is 5-(4,11-diamino-1,3,5,10-tetraoxonaphtho[2,3-f]isoindol-2-yl)benzene-1,3-dicarboxylic acid.
| Compound Name | 5-(4,11-diamino-1,3,5,10-tetraoxonaphtho[2,3-f]isoindol-2-yl)benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 23517659 |
| Molecular Formula | C24H13N3O8 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 5-(4,11-diamino-1,3,5,10-tetraoxonaphtho[2,3-f]isoindol-2-yl)benzene-1,3-dicarboxylic acid |
| SMILES | Nc1c2c(=O)c3ccccc3c(=O)c2c(N)c2c(=O)n(-c3cc(C(=O)O)cc(C(=O)O)c3)c(=O)c12 |
| InChI | InChI=1S/C24H13N3O8/c25-17-13-14(20(29)12-4-2-1-3-11(12)19(13)28)18(26)16-15(17)21(30)27(22(16)31)10-6-8(23(32)33)5-9(7-10)24(34)35/h1-7H,25-26H2,(H,32,33)(H,34,35) |
| InChIKey | YNOPIGJAHXXLBJ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 199.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|