C27H12N2O6 — CID 156684998
3-ethynyl-5-[6-(3-ethynylphenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]benzoic acid (PubChem CID 156684998) has the molecular formula C27H12N2O6 and a molecular weight of 460.40 g/mol. Its IUPAC name is 3-ethynyl-5-[6-(3-ethynylphenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]benzoic acid.
| Compound Name | 3-ethynyl-5-[6-(3-ethynylphenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]benzoic acid |
|---|---|
| PubChem CID | 156684998 |
| Molecular Formula | C27H12N2O6 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.07 |
| IUPAC Name | 3-ethynyl-5-[6-(3-ethynylphenyl)-1,3,5,7-tetraoxopyrrolo[3,4-f]isoindol-2-yl]benzoic acid |
| SMILES | C#Cc1cccc(-n2c(=O)c3cc4c(=O)n(-c5cc(C#C)cc(C(=O)O)c5)c(=O)c4cc3c2=O)c1 |
| InChI | InChI=1S/C27H12N2O6/c1-3-14-6-5-7-17(9-14)28-23(30)19-12-21-22(13-20(19)24(28)31)26(33)29(25(21)32)18-10-15(4-2)8-16(11-18)27(34)35/h1-2,5-13H,(H,34,35) |
| InChIKey | AIABEBPZVGIJAS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 115.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|