C25H18N2O4 — CID 156684987
3-ethynyl-5-[9-(3-ethynylphenyl)-8,10-dioxo-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]benzoic acid (PubChem CID 156684987) has the molecular formula C25H18N2O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is 3-ethynyl-5-[9-(3-ethynylphenyl)-8,10-dioxo-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]benzoic acid.
| Compound Name | 3-ethynyl-5-[9-(3-ethynylphenyl)-8,10-dioxo-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]benzoic acid |
|---|---|
| PubChem CID | 156684987 |
| Molecular Formula | C25H18N2O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-ethynyl-5-[9-(3-ethynylphenyl)-8,10-dioxo-4,9-diazatricyclo[5.3.0.02,6]decan-4-yl]benzoic acid |
| SMILES | C#Cc1cc(C(=O)O)cc(N2CC3C(C2)C2C(=O)N(c4cccc(C#C)c4)C(=O)C32)c1 |
| InChI | InChI=1S/C25H18N2O4/c1-3-14-6-5-7-17(9-14)27-23(28)21-19-12-26(13-20(19)22(21)24(27)29)18-10-15(4-2)8-16(11-18)25(30)31/h1-2,5-11,19-22H,12-13H2,(H,30,31) |
| InChIKey | WWESIAKRJXTVKB-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|