C64H90N2O4 — CID 154619762
2,4-Bis[10-(dioctylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diol (PubChem CID 154619762) has the molecular formula C64H90N2O4 and a molecular weight of 951.40 g/mol. Its IUPAC name is 2,4-bis[10-(dioctylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diol.
| Compound Name | 2,4-Bis[10-(dioctylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 154619762 |
| Molecular Formula | C64H90N2O4 |
| Molecular Weight | 951.40 g/mol |
| Exact Mass | 950.69 |
| IUPAC Name | 2,4-bis[10-(dioctylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diol |
| SMILES | CCCCCCCCN(CCCCCCCC)C1=C2C=CC=C(C2=C(C3=CC=CC=C31)C4C(C(C4O)C5=C6C(=C(C7=CC=CC=C75)N(CCCCCCCC)CCCCCCCC)C=CC=C6O)O)O |
| InChI | InChI=1S/C64H90N2O4/c1-5-9-13-17-21-29-43-65(44-30-22-18-14-10-6-2)61-49-37-27-25-35-47(49)57(55-51(61)39-33-41-53(55)67)59-63(69)60(64(59)70)58-48-36-26-28-38-50(48)62(52-40-34-42-54(68)56(52)58)66(45-31-23-19-15-11-7-3)46-32-24-20-16-12-8-4/h25-28,33-42,59-60,63-64,67-70H,5-24,29-32,43-46H2,1-4H3 |
| InChIKey | GIXZRSZHGUHSEB-UHFFFAOYSA-N |
| XLogP | 20.50 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 70 |
| Complexity | 1250 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 951.40 |
| LogP ≤ 5 | 20.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|