C52H70N6O2 — CID 154620085
2,4-bis[1,8-diamino-10-(dipentylamino)anthracen-9-yl]cyclobutane-1,3-diol (PubChem CID 154620085) has the molecular formula C52H70N6O2 and a molecular weight of 811.17 g/mol. Its IUPAC name is 2,4-bis[1,8-diamino-10-(dipentylamino)anthracen-9-yl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[1,8-diamino-10-(dipentylamino)anthracen-9-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 154620085 |
| Molecular Formula | C52H70N6O2 |
| Molecular Weight | 811.17 g/mol |
| Exact Mass | 810.56 |
| IUPAC Name | 2,4-bis[1,8-diamino-10-(dipentylamino)anthracen-9-yl]cyclobutane-1,3-diol |
| SMILES | CCCCCN(CCCCC)c1c2cccc(N)c2c(C2C(O)C(c3c4c(N)cccc4c(N(CCCCC)CCCCC)c4cccc(N)c34)C2O)c2c(N)cccc12 |
| InChI | InChI=1S/C52H70N6O2/c1-5-9-13-29-57(30-14-10-6-2)49-33-21-17-25-37(53)41(33)45(42-34(49)22-18-26-38(42)54)47-51(59)48(52(47)60)46-43-35(23-19-27-39(43)55)50(36-24-20-28-40(56)44(36)46)58(31-15-11-7-3)32-16-12-8-4/h17-28,47-48,51-52,59-60H,5-16,29-32,53-56H2,1-4H3 |
| InChIKey | FSFCMLVCLBCTJA-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 60 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.17 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|