C44H48N2O4-2 — CID 154619783
2,4-bis[10-(dipropylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diolate (PubChem CID 154619783) has the molecular formula C44H48N2O4-2 and a molecular weight of 668.88 g/mol. Its IUPAC name is 2,4-bis[10-(dipropylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[10-(dipropylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619783 |
| Molecular Formula | C44H48N2O4-2 |
| Molecular Weight | 668.88 g/mol |
| Exact Mass | 668.36 |
| IUPAC Name | 2,4-bis[10-(dipropylamino)-1-hydroxyanthracen-9-yl]cyclobutane-1,3-diolate |
| SMILES | CCCN(CCC)c1c2ccccc2c(C2C([O-])C(c3c4ccccc4c(N(CCC)CCC)c4cccc(O)c34)C2[O-])c2c(O)cccc12 |
| InChI | InChI=1S/C44H48N2O4/c1-5-23-45(24-6-2)41-29-17-11-9-15-27(29)37(35-31(41)19-13-21-33(35)47)39-43(49)40(44(39)50)38-28-16-10-12-18-30(28)42(46(25-7-3)26-8-4)32-20-14-22-34(48)36(32)38/h9-22,39-40,43-44,47-48H,5-8,23-26H2,1-4H3/q-2 |
| InChIKey | FVLJIYLBRCSFOE-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.88 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|