C38H38N4O2-2 — CID 154619613
2-[1,8-diamino-10-(dimethylamino)anthracen-9-yl]-4-[10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diolate (PubChem CID 154619613) has the molecular formula C38H38N4O2-2 and a molecular weight of 582.75 g/mol. Its IUPAC name is 2-[1,8-diamino-10-(dimethylamino)anthracen-9-yl]-4-[10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diolate.
| Compound Name | 2-[1,8-diamino-10-(dimethylamino)anthracen-9-yl]-4-[10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619613 |
| Molecular Formula | C38H38N4O2-2 |
| Molecular Weight | 582.75 g/mol |
| Exact Mass | 582.30 |
| IUPAC Name | 2-[1,8-diamino-10-(dimethylamino)anthracen-9-yl]-4-[10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diolate |
| SMILES | CCN(CC)c1c2ccccc2c(C2C([O-])C(c3c4c(N)cccc4c(N(C)C)c4cccc(N)c34)C2[O-])c2ccccc12 |
| InChI | InChI=1S/C38H38N4O2/c1-5-42(6-2)36-23-15-9-7-13-21(23)29(22-14-8-10-16-24(22)36)33-37(43)34(38(33)44)32-30-25(17-11-19-27(30)39)35(41(3)4)26-18-12-20-28(40)31(26)32/h7-20,33-34,37-38H,5-6,39-40H2,1-4H3/q-2 |
| InChIKey | YIQYCOQDGIDWTH-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.75 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|