C40H42N4O2-2 — CID 154619543
2,4-bis[4,10-bis(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diolate (PubChem CID 154619543) has the molecular formula C40H42N4O2-2 and a molecular weight of 610.80 g/mol. Its IUPAC name is 2,4-bis[4,10-bis(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[4,10-bis(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619543 |
| Molecular Formula | C40H42N4O2-2 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | 2,4-bis[4,10-bis(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diolate |
| SMILES | CN(C)c1ccc(C2C([O-])C(c3ccc(N(C)C)c4c(N(C)C)c5ccccc5cc34)C2[O-])c2cc3ccccc3c(N(C)C)c12 |
| InChI | InChI=1S/C40H42N4O2/c1-41(2)31-19-17-27(29-21-23-13-9-11-15-25(23)37(33(29)31)43(5)6)35-39(45)36(40(35)46)28-18-20-32(42(3)4)34-30(28)22-24-14-10-12-16-26(24)38(34)44(7)8/h9-22,35-36,39-40H,1-8H3/q-2 |
| InChIKey | UFTJYQQNOQPVJN-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|