C47H48N2O3-2 — CID 164791469
4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-2-[4-(dimethylamino)anthracen-1-yl]-5-oxocyclopentane-1,3-diolate (PubChem CID 164791469) has the molecular formula C47H48N2O3-2 and a molecular weight of 688.91 g/mol. Its IUPAC name is 4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-2-[4-(dimethylamino)anthracen-1-yl]-5-oxocyclopentane-1,3-diolate.
| Compound Name | 4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-2-[4-(dimethylamino)anthracen-1-yl]-5-oxocyclopentane-1,3-diolate |
|---|---|
| PubChem CID | 164791469 |
| Molecular Formula | C47H48N2O3-2 |
| Molecular Weight | 688.91 g/mol |
| Exact Mass | 688.37 |
| IUPAC Name | 4-[4-(4-tert-butyl-N-(4-tert-butylphenyl)anilino)phenyl]-2-[4-(dimethylamino)anthracen-1-yl]-5-oxocyclopentane-1,3-diolate |
| SMILES | CN(C)c1ccc(C2C([O-])C(=O)C(c3ccc(N(c4ccc(C(C)(C)C)cc4)c4ccc(C(C)(C)C)cc4)cc3)C2[O-])c2cc3ccccc3cc12 |
| InChI | InChI=1S/C47H48N2O3/c1-46(2,3)32-15-21-35(22-16-32)49(36-23-17-33(18-24-36)47(4,5)6)34-19-13-29(14-20-34)41-43(50)42(45(52)44(41)51)37-25-26-40(48(7)8)39-28-31-12-10-9-11-30(31)27-38(37)39/h9-28,41-43,45H,1-8H3/q-2 |
| InChIKey | NXWZRSJUCKHEAH-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.91 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|