C38H39N3O2 — CID 155054178
2-[4,10-bis(dimethylamino)anthracen-1-yl]-4-[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diol (PubChem CID 155054178) has the molecular formula C38H39N3O2 and a molecular weight of 569.75 g/mol. Its IUPAC name is 2-[4,10-bis(dimethylamino)anthracen-1-yl]-4-[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diol.
| Compound Name | 2-[4,10-bis(dimethylamino)anthracen-1-yl]-4-[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 155054178 |
| Molecular Formula | C38H39N3O2 |
| Molecular Weight | 569.75 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 2-[4,10-bis(dimethylamino)anthracen-1-yl]-4-[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-diol |
| SMILES | CN(C)c1ccc(C2C(O)C(c3ccc(N(C)C)c4c(N(C)C)c5ccccc5cc34)C2O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C38H39N3O2/c1-39(2)31-17-15-26(28-19-22-11-7-8-12-23(22)20-29(28)31)34-37(42)35(38(34)43)27-16-18-32(40(3)4)33-30(27)21-24-13-9-10-14-25(24)36(33)41(5)6/h7-21,34-35,37-38,42-43H,1-6H3 |
| InChIKey | HJXLIYHXNFUQQU-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.75 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|