C37H37N3O2 — CID 154620037
2-[4-(dimethylamino)anthracen-1-yl]-4-[10-(dimethylamino)-4-(methylamino)anthracen-1-yl]cyclobutane-1,3-diol (PubChem CID 154620037) has the molecular formula C37H37N3O2 and a molecular weight of 555.72 g/mol. Its IUPAC name is 2-[4-(dimethylamino)anthracen-1-yl]-4-[10-(dimethylamino)-4-(methylamino)anthracen-1-yl]cyclobutane-1,3-diol.
| Compound Name | 2-[4-(dimethylamino)anthracen-1-yl]-4-[10-(dimethylamino)-4-(methylamino)anthracen-1-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 154620037 |
| Molecular Formula | C37H37N3O2 |
| Molecular Weight | 555.72 g/mol |
| Exact Mass | 555.29 |
| IUPAC Name | 2-[4-(dimethylamino)anthracen-1-yl]-4-[10-(dimethylamino)-4-(methylamino)anthracen-1-yl]cyclobutane-1,3-diol |
| SMILES | CNc1ccc(C2C(O)C(c3ccc(N(C)C)c4cc5ccccc5cc34)C2O)c2cc3ccccc3c(N(C)C)c12 |
| InChI | InChI=1S/C37H37N3O2/c1-38-30-16-14-26(29-20-23-12-8-9-13-24(23)35(32(29)30)40(4)5)34-36(41)33(37(34)42)25-15-17-31(39(2)3)28-19-22-11-7-6-10-21(22)18-27(25)28/h6-20,33-34,36-38,41-42H,1-5H3 |
| InChIKey | KQWHIHISQYDXIW-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.72 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|