C36H30N2O2 — CID 91429337
2,4-bis[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-dione (PubChem CID 91429337) has the molecular formula C36H30N2O2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 2,4-bis[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-dione.
| Compound Name | 2,4-bis[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-dione |
|---|---|
| PubChem CID | 91429337 |
| Molecular Formula | C36H30N2O2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.23 |
| IUPAC Name | 2,4-bis[4-(dimethylamino)anthracen-1-yl]cyclobutane-1,3-dione |
| SMILES | CN(C)c1ccc(C2C(=O)C(c3ccc(N(C)C)c4cc5ccccc5cc34)C2=O)c2cc3ccccc3cc12 |
| InChI | InChI=1S/C36H30N2O2/c1-37(2)31-15-13-25(27-17-21-9-5-7-11-23(21)19-29(27)31)33-35(39)34(36(33)40)26-14-16-32(38(3)4)30-20-24-12-8-6-10-22(24)18-28(26)30/h5-20,33-34H,1-4H3 |
| InChIKey | WWGJRWCQFVMRMA-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|