C19H22N2 — CID 139804064
2-N,2-N,6-N,6-N,1-pentamethylanthracene-2,6-diamine (PubChem CID 139804064) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 2-N,2-N,6-N,6-N,1-pentamethylanthracene-2,6-diamine.
| Compound Name | 2-N,2-N,6-N,6-N,1-pentamethylanthracene-2,6-diamine |
|---|---|
| PubChem CID | 139804064 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 2-N,2-N,6-N,6-N,1-pentamethylanthracene-2,6-diamine |
| SMILES | Cc1c(N(C)C)ccc2cc3cc(N(C)C)ccc3cc12 |
| InChI | InChI=1S/C19H22N2/c1-13-18-12-14-6-8-17(20(2)3)11-16(14)10-15(18)7-9-19(13)21(4)5/h6-12H,1-5H3 |
| InChIKey | WJXRBYZKVZUJHO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|