C44H56N10O2-2 — CID 154619505
2,4-bis[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]cyclobutane-1,3-diolate (PubChem CID 154619505) has the molecular formula C44H56N10O2-2 and a molecular weight of 757.00 g/mol. Its IUPAC name is 2,4-bis[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]cyclobutane-1,3-diolate.
| Compound Name | 2,4-bis[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 154619505 |
| Molecular Formula | C44H56N10O2-2 |
| Molecular Weight | 757.00 g/mol |
| Exact Mass | 756.46 |
| IUPAC Name | 2,4-bis[1,8-diamino-4,5,10-tris(dimethylamino)anthracen-9-yl]cyclobutane-1,3-diolate |
| SMILES | CN(C)c1ccc(N)c2c(C3C([O-])C(c4c5c(N)ccc(N(C)C)c5c(N(C)C)c5c(N(C)C)ccc(N)c45)C3[O-])c3c(N)ccc(N(C)C)c3c(N(C)C)c12 |
| InChI | InChI=1S/C44H56N10O2/c1-49(2)25-17-13-21(45)29-33(25)41(53(9)10)34-26(50(3)4)18-14-22(46)30(34)37(29)39-43(55)40(44(39)56)38-31-23(47)15-19-27(51(5)6)35(31)42(54(11)12)36-28(52(7)8)20-16-24(48)32(36)38/h13-20,39-40,43-44H,45-48H2,1-12H3/q-2 |
| InChIKey | NVWJPGAGZBELHX-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 169.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.00 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|