C40H46N6O2 — CID 154619768
2,4-bis[1,8-diamino-10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diol (PubChem CID 154619768) has the molecular formula C40H46N6O2 and a molecular weight of 642.85 g/mol. Its IUPAC name is 2,4-bis[1,8-diamino-10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diol.
| Compound Name | 2,4-bis[1,8-diamino-10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 154619768 |
| Molecular Formula | C40H46N6O2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.37 |
| IUPAC Name | 2,4-bis[1,8-diamino-10-(diethylamino)anthracen-9-yl]cyclobutane-1,3-diol |
| SMILES | CCN(CC)c1c2cccc(N)c2c(C2C(O)C(c3c4c(N)cccc4c(N(CC)CC)c4cccc(N)c34)C2O)c2c(N)cccc12 |
| InChI | InChI=1S/C40H46N6O2/c1-5-45(6-2)37-21-13-9-17-25(41)29(21)33(30-22(37)14-10-18-26(30)42)35-39(47)36(40(35)48)34-31-23(15-11-19-27(31)43)38(46(7-3)8-4)24-16-12-20-28(44)32(24)34/h9-20,35-36,39-40,47-48H,5-8,41-44H2,1-4H3 |
| InChIKey | KWKOECGQFNLPLP-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 151.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|