C38H31NO2 — CID 59951432
N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-naphthalen-2-ylethenyl]aniline (PubChem CID 59951432) has the molecular formula C38H31NO2 and a molecular weight of 533.67 g/mol. Its IUPAC name is N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-naphthalen-2-ylethenyl]aniline.
| Compound Name | N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-naphthalen-2-ylethenyl]aniline |
|---|---|
| PubChem CID | 59951432 |
| Molecular Formula | C38H31NO2 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-naphthalen-2-ylethenyl]aniline |
| SMILES | C(=C/c1ccc2ccccc2c1)\c1ccc(N(/C=C2\CCOc3ccccc32)/C=C2\CCOc3ccccc32)cc1 |
| InChI | InChI=1S/C38H31NO2/c1-2-8-31-25-29(15-18-30(31)7-1)14-13-28-16-19-34(20-17-28)39(26-32-21-23-40-37-11-5-3-9-35(32)37)27-33-22-24-41-38-12-6-4-10-36(33)38/h1-20,25-27H,21-24H2/b14-13+,32-26+,33-27+ |
| InChIKey | RMGOWIGPYCGYOS-CQVJKFONSA-N |
| XLogP | 9.46 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|