C35H31NO3 — CID 59951443
N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline (PubChem CID 59951443) has the molecular formula C35H31NO3 and a molecular weight of 513.64 g/mol. Its IUPAC name is N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline.
| Compound Name | N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 59951443 |
| Molecular Formula | C35H31NO3 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | N,N-bis[(E)-2,3-dihydrochromen-4-ylidenemethyl]-4-[(E)-2-(4-methoxyphenyl)ethenyl]aniline |
| SMILES | COc1ccc(/C=C/c2ccc(N(/C=C3\CCOc4ccccc43)/C=C3\CCOc4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C35H31NO3/c1-37-31-18-14-27(15-19-31)11-10-26-12-16-30(17-13-26)36(24-28-20-22-38-34-8-4-2-6-32(28)34)25-29-21-23-39-35-9-5-3-7-33(29)35/h2-19,24-25H,20-23H2,1H3/b11-10+,28-24+,29-25+ |
| InChIKey | SUJRGGLUODNWFQ-WMNOGXRYSA-N |
| XLogP | 8.32 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|