C37H37N3O — CID 72604623
4-[2-(4-methoxyphenyl)ethenyl]-N,N-bis[(1-methyl-2,3-dihydroquinolin-4-ylidene)methyl]aniline (PubChem CID 72604623) has the molecular formula C37H37N3O and a molecular weight of 539.72 g/mol. Its IUPAC name is 4-[2-(4-methoxyphenyl)ethenyl]-N,N-bis[(1-methyl-2,3-dihydroquinolin-4-ylidene)methyl]aniline.
| Compound Name | 4-[2-(4-methoxyphenyl)ethenyl]-N,N-bis[(1-methyl-2,3-dihydroquinolin-4-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 72604623 |
| Molecular Formula | C37H37N3O |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.29 |
| IUPAC Name | 4-[2-(4-methoxyphenyl)ethenyl]-N,N-bis[(1-methyl-2,3-dihydroquinolin-4-ylidene)methyl]aniline |
| SMILES | COc1ccc(C=Cc2ccc(N(C=C3CCN(C)c4ccccc43)C=C3CCN(C)c4ccccc43)cc2)cc1 |
| InChI | InChI=1S/C37H37N3O/c1-38-24-22-30(34-8-4-6-10-36(34)38)26-40(27-31-23-25-39(2)37-11-7-5-9-35(31)37)32-18-14-28(15-19-32)12-13-29-16-20-33(41-3)21-17-29/h4-21,26-27H,22-25H2,1-3H3 |
| InChIKey | LFGQLJBELOPIIV-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|