C10H6Cl2N2OS — CID 599535
2,4-dichloro-N-(1,3-thiazol-2-yl)benzamide (PubChem CID 599535) has the molecular formula C10H6Cl2N2OS and a molecular weight of 273.14 g/mol. Its IUPAC name is 2,4-dichloro-N-(1,3-thiazol-2-yl)benzamide.
| Compound Name | 2,4-dichloro-N-(1,3-thiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 599535 |
| Molecular Formula | C10H6Cl2N2OS |
| Molecular Weight | 273.14 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 2,4-dichloro-N-(1,3-thiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nccs1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H6Cl2N2OS/c11-6-1-2-7(8(12)5-6)9(15)14-10-13-3-4-16-10/h1-5H,(H,13,14,15) |
| InChIKey | TYJWBXUICUJRNJ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |