C31H42N2O7S — CID 59954216
(E)-5-(1-adamantylmethylsulfanyl)-3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopent-2-enoic acid (PubChem CID 59954216) has the molecular formula C31H42N2O7S and a molecular weight of 586.75 g/mol. Its IUPAC name is (E)-5-(1-adamantylmethylsulfanyl)-3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopent-2-enoic acid.
| Compound Name | (E)-5-(1-adamantylmethylsulfanyl)-3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopent-2-enoic acid |
|---|---|
| PubChem CID | 59954216 |
| Molecular Formula | C31H42N2O7S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (E)-5-(1-adamantylmethylsulfanyl)-3-[[(2S)-2-[[2-(2,5-dimethoxyphenyl)acetyl]amino]-3-methylbutanoyl]amino]-4-oxopent-2-enoic acid |
| SMILES | COc1ccc(OC)c(CC(=O)N[C@H](C(=O)N/C(=C/C(=O)O)C(=O)CSCC23CC4CC(CC(C4)C2)C3)C(C)C)c1 |
| InChI | InChI=1S/C31H42N2O7S/c1-18(2)29(33-27(35)11-22-10-23(39-3)5-6-26(22)40-4)30(38)32-24(12-28(36)37)25(34)16-41-17-31-13-19-7-20(14-31)9-21(8-19)15-31/h5-6,10,12,18-21,29H,7-9,11,13-17H2,1-4H3,(H,32,38)(H,33,35)(H,36,37)/b24-12+/t19?,20?,21?,29-,31?/m0/s1 |
| InChIKey | VLRVNUYWTCUIFO-NRBQBVCBSA-N |
| XLogP | 3.99 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|