C15H20N4O4 — CID 59954799
methyl (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-2-pyridinyl]-2-methoxyiminoacetate (PubChem CID 59954799) has the molecular formula C15H20N4O4 and a molecular weight of 320.35 g/mol. Its IUPAC name is methyl (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-2-pyridinyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-2-pyridinyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 59954799 |
| Molecular Formula | C15H20N4O4 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | methyl (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-2-pyridinyl]-2-methoxyiminoacetate |
| SMILES | CC/N=C(C)/C(C)=N/Oc1cccnc1/C(=N\OC)C(=O)OC |
| InChI | InChI=1S/C15H20N4O4/c1-6-16-10(2)11(3)18-23-12-8-7-9-17-13(12)14(19-22-5)15(20)21-4/h7-9H,6H2,1-5H3/b16-10+,18-11+,19-14+ |
| InChIKey | LMLJYAVNNIKOBV-LJEMJMDFSA-N |
| XLogP | 1.84 |
| TPSA | 94.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|