C15H21N5O3 — CID 59954790
(2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-4-pyridinyl]-2-methoxyimino-N-methylacetamide (PubChem CID 59954790) has the molecular formula C15H21N5O3 and a molecular weight of 319.37 g/mol. Its IUPAC name is (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-4-pyridinyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-4-pyridinyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 59954790 |
| Molecular Formula | C15H21N5O3 |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | (2E)-2-[3-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-4-pyridinyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CC/N=C(C)/C(C)=N/Oc1cnccc1/C(=N\OC)C(=O)NC |
| InChI | InChI=1S/C15H21N5O3/c1-6-18-10(2)11(3)19-23-13-9-17-8-7-12(13)14(20-22-5)15(21)16-4/h7-9H,6H2,1-5H3,(H,16,21)/b18-10+,19-11+,20-14+ |
| InChIKey | UHAPKKUKSWKVLR-NRYVMDNWSA-N |
| XLogP | 1.41 |
| TPSA | 97.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|