C18H17N3O3S — CID 174359361
2-[2-[1,3-benzothiazol-2-yl(hydroxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 174359361) has the molecular formula C18H17N3O3S and a molecular weight of 355.42 g/mol. Its IUPAC name is 2-[2-[1,3-benzothiazol-2-yl(hydroxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[1,3-benzothiazol-2-yl(hydroxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 174359361 |
| Molecular Formula | C18H17N3O3S |
| Molecular Weight | 355.42 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | 2-[2-[1,3-benzothiazol-2-yl(hydroxy)methyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1C(O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C18H17N3O3S/c1-19-17(23)15(21-24-2)11-7-3-4-8-12(11)16(22)18-20-13-9-5-6-10-14(13)25-18/h3-10,16,22H,1-2H3,(H,19,23) |
| InChIKey | RZGORUJZZFXQRU-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|