C19H26N4O4 — CID 86758337
2-methoxyimino-2-[2-[1-[(2-methoxyimino-4-methylpent-4-enylidene)amino]oxyethyl]phenyl]-N-methylacetamide (PubChem CID 86758337) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-methoxyimino-2-[2-[1-[(2-methoxyimino-4-methylpent-4-enylidene)amino]oxyethyl]phenyl]-N-methylacetamide.
| Compound Name | 2-methoxyimino-2-[2-[1-[(2-methoxyimino-4-methylpent-4-enylidene)amino]oxyethyl]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 86758337 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 2-methoxyimino-2-[2-[1-[(2-methoxyimino-4-methylpent-4-enylidene)amino]oxyethyl]phenyl]-N-methylacetamide |
| SMILES | C=C(C)CC(C=NOC(C)c1ccccc1C(=NOC)C(=O)NC)=NOC |
| InChI | InChI=1S/C19H26N4O4/c1-13(2)11-15(22-25-5)12-21-27-14(3)16-9-7-8-10-17(16)18(23-26-6)19(24)20-4/h7-10,12,14H,1,11H2,2-6H3,(H,20,24) |
| InChIKey | HIUUFHIHAHRTHA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 93.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|