C16H21N3O3 — CID 59954813
methyl (E)-2-[2-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-3-pyridinyl]but-2-enoate (PubChem CID 59954813) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is methyl (E)-2-[2-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-3-pyridinyl]but-2-enoate.
| Compound Name | methyl (E)-2-[2-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-3-pyridinyl]but-2-enoate |
|---|---|
| PubChem CID | 59954813 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | methyl (E)-2-[2-[(E)-3-ethyliminobutan-2-ylideneamino]oxy-3-pyridinyl]but-2-enoate |
| SMILES | C/C=C(/C(=O)OC)c1cccnc1O/N=C(C)/C(C)=N/CC |
| InChI | InChI=1S/C16H21N3O3/c1-6-13(16(20)21-5)14-9-8-10-18-15(14)22-19-12(4)11(3)17-7-2/h6,8-10H,7H2,1-5H3/b13-6+,17-11+,19-12+ |
| InChIKey | QQLHPPAPIDWGAH-CRWSMSAWSA-N |
| XLogP | 2.89 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|