C16H24N4O4 — CID 172962636
azane;(E)-3-[2-[(E)-[(3E)-3-ethoxyiminobutan-2-ylidene]amino]oxy-3-pyridinyl]-4-methoxybut-3-en-2-one (PubChem CID 172962636) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is azane;(E)-3-[2-[(E)-[(3E)-3-ethoxyiminobutan-2-ylidene]amino]oxy-3-pyridinyl]-4-methoxybut-3-en-2-one.
| Compound Name | azane;(E)-3-[2-[(E)-[(3E)-3-ethoxyiminobutan-2-ylidene]amino]oxy-3-pyridinyl]-4-methoxybut-3-en-2-one |
|---|---|
| PubChem CID | 172962636 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | azane;(E)-3-[2-[(E)-[(3E)-3-ethoxyiminobutan-2-ylidene]amino]oxy-3-pyridinyl]-4-methoxybut-3-en-2-one |
| SMILES | CCO/N=C(C)/C(C)=N/Oc1ncccc1/C(=C\OC)C(C)=O.N |
| InChI | InChI=1S/C16H21N3O4.H3N/c1-6-22-18-11(2)12(3)19-23-16-14(8-7-9-17-16)15(10-21-5)13(4)20;/h7-10H,6H2,1-5H3;1H3/b15-10-,18-11+,19-12+; |
| InChIKey | JABRJNLLZWTLER-QDOLEPNJSA-N |
| XLogP | 2.99 |
| TPSA | 117.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|