C10H19NO — CID 59955315
(2S)-2,4-dimethyl-N-prop-2-enylpentanamide (PubChem CID 59955315) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2S)-2,4-dimethyl-N-prop-2-enylpentanamide.
| Compound Name | (2S)-2,4-dimethyl-N-prop-2-enylpentanamide |
|---|---|
| PubChem CID | 59955315 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2S)-2,4-dimethyl-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)[C@@H](C)CC(C)C |
| InChI | InChI=1S/C10H19NO/c1-5-6-11-10(12)9(4)7-8(2)3/h5,8-9H,1,6-7H2,2-4H3,(H,11,12)/t9-/m0/s1 |
| InChIKey | DJFJIJNYUBPHIY-VIFPVBQESA-N |
| XLogP | 1.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|