C11H19F2NO — CID 178011026
N-[(E)-but-2-enyl]-2-cyclopropyl-2,2-difluoroacetamide;ethane (PubChem CID 178011026) has the molecular formula C11H19F2NO and a molecular weight of 219.27 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2-cyclopropyl-2,2-difluoroacetamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-2-cyclopropyl-2,2-difluoroacetamide;ethane |
|---|---|
| PubChem CID | 178011026 |
| Molecular Formula | C11H19F2NO |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-[(E)-but-2-enyl]-2-cyclopropyl-2,2-difluoroacetamide;ethane |
| SMILES | C/C=C/CNC(=O)C(F)(F)C1CC1.CC |
| InChI | InChI=1S/C9H13F2NO.C2H6/c1-2-3-6-12-8(13)9(10,11)7-4-5-7;1-2/h2-3,7H,4-6H2,1H3,(H,12,13);1-2H3/b3-2+; |
| InChIKey | UISOZCUHNAFOJU-SQQVDAMQSA-N |
| XLogP | 2.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|