C11H17F2NO — CID 178010167
2,2-difluoro-N-[(E)-4-methylpent-2-enyl]cyclobutane-1-carboxamide (PubChem CID 178010167) has the molecular formula C11H17F2NO and a molecular weight of 217.26 g/mol. Its IUPAC name is 2,2-difluoro-N-[(E)-4-methylpent-2-enyl]cyclobutane-1-carboxamide.
| Compound Name | 2,2-difluoro-N-[(E)-4-methylpent-2-enyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 178010167 |
| Molecular Formula | C11H17F2NO |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2,2-difluoro-N-[(E)-4-methylpent-2-enyl]cyclobutane-1-carboxamide |
| SMILES | CC(C)/C=C/CNC(=O)C1CCC1(F)F |
| InChI | InChI=1S/C11H17F2NO/c1-8(2)4-3-7-14-10(15)9-5-6-11(9,12)13/h3-4,8-9H,5-7H2,1-2H3,(H,14,15)/b4-3+ |
| InChIKey | SSHDTMLHYVSZKM-ONEGZZNKSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|