C13H17F2NO — CID 156730180
(4Z)-N-(3,3-difluorocyclobutyl)-4-methyl-3-methylidenehepta-4,6-dienamide (PubChem CID 156730180) has the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. Its IUPAC name is (4Z)-N-(3,3-difluorocyclobutyl)-4-methyl-3-methylidenehepta-4,6-dienamide.
| Compound Name | (4Z)-N-(3,3-difluorocyclobutyl)-4-methyl-3-methylidenehepta-4,6-dienamide |
|---|---|
| PubChem CID | 156730180 |
| Molecular Formula | C13H17F2NO |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | (4Z)-N-(3,3-difluorocyclobutyl)-4-methyl-3-methylidenehepta-4,6-dienamide |
| SMILES | C=C/C=C(/C)C(=C)CC(=O)NC1CC(F)(F)C1 |
| InChI | InChI=1S/C13H17F2NO/c1-4-5-9(2)10(3)6-12(17)16-11-7-13(14,15)8-11/h4-5,11H,1,3,6-8H2,2H3,(H,16,17)/b9-5- |
| InChIKey | HBGPGXRJONLZID-UITAMQMPSA-N |
| XLogP | 2.98 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|