C12H23F2NO — CID 178011570
N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane (PubChem CID 178011570) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 178011570 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane |
| SMILES | C/C=C/CNC(=O)C1CC1(F)F.CC.CC |
| InChI | InChI=1S/C8H11F2NO.2C2H6/c1-2-3-4-11-7(12)6-5-8(6,9)10;2*1-2/h2-3,6H,4-5H2,1H3,(H,11,12);2*1-2H3/b3-2+;; |
| InChIKey | VXTQQKHTXIPIII-WTVBWJGASA-N |
| XLogP | 3.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|