C9H13F2NO — CID 178011001
N-[(E)-but-2-enyl]-1-(difluoromethyl)cyclopropane-1-carboxamide (PubChem CID 178011001) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-1-(difluoromethyl)cyclopropane-1-carboxamide.
| Compound Name | N-[(E)-but-2-enyl]-1-(difluoromethyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178011001 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | N-[(E)-but-2-enyl]-1-(difluoromethyl)cyclopropane-1-carboxamide |
| SMILES | C/C=C/CNC(=O)C1(C(F)F)CC1 |
| InChI | InChI=1S/C9H13F2NO/c1-2-3-6-12-8(13)9(4-5-9)7(10)11/h2-3,7H,4-6H2,1H3,(H,12,13)/b3-2+ |
| InChIKey | JNMUCKUHIPFTMJ-NSCUHMNNSA-N |
| XLogP | 1.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|