C8H11F2NO — CID 178010707
1-(difluoromethyl)-N-prop-2-enylcyclopropane-1-carboxamide (PubChem CID 178010707) has the molecular formula C8H11F2NO and a molecular weight of 175.18 g/mol. Its IUPAC name is 1-(difluoromethyl)-N-prop-2-enylcyclopropane-1-carboxamide.
| Compound Name | 1-(difluoromethyl)-N-prop-2-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 178010707 |
| Molecular Formula | C8H11F2NO |
| Molecular Weight | 175.18 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | 1-(difluoromethyl)-N-prop-2-enylcyclopropane-1-carboxamide |
| SMILES | C=CCNC(=O)C1(C(F)F)CC1 |
| InChI | InChI=1S/C8H11F2NO/c1-2-5-11-7(12)8(3-4-8)6(9)10/h2,6H,1,3-5H2,(H,11,12) |
| InChIKey | POBZXOQUFSAPPX-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.18 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|