C10H17F2NO — CID 178010795
N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane (PubChem CID 178010795) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane.
| Compound Name | N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane |
|---|---|
| PubChem CID | 178010795 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-[(E)-but-2-enyl]-2,2-difluorocyclopropane-1-carboxamide;ethane |
| SMILES | C/C=C/CNC(=O)C1CC1(F)F.CC |
| InChI | InChI=1S/C8H11F2NO.C2H6/c1-2-3-4-11-7(12)6-5-8(6,9)10;1-2/h2-3,6H,4-5H2,1H3,(H,11,12);1-2H3/b3-2+; |
| InChIKey | WZNJMWQXQKXKPE-SQQVDAMQSA-N |
| XLogP | 2.36 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|