C8H9F6NO — CID 71672164
3,3,3-trifluoro-2-methyl-N-prop-2-enyl-2-(trifluoromethyl)propanamide (PubChem CID 71672164) has the molecular formula C8H9F6NO and a molecular weight of 249.15 g/mol. Its IUPAC name is 3,3,3-trifluoro-2-methyl-N-prop-2-enyl-2-(trifluoromethyl)propanamide.
| Compound Name | 3,3,3-trifluoro-2-methyl-N-prop-2-enyl-2-(trifluoromethyl)propanamide |
|---|---|
| PubChem CID | 71672164 |
| Molecular Formula | C8H9F6NO |
| Molecular Weight | 249.15 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 3,3,3-trifluoro-2-methyl-N-prop-2-enyl-2-(trifluoromethyl)propanamide |
| SMILES | C=CCNC(=O)C(C)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H9F6NO/c1-3-4-15-5(16)6(2,7(9,10)11)8(12,13)14/h3H,1,4H2,2H3,(H,15,16) |
| InChIKey | FLSDJQVWOAVOMV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.15 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|