C9H13F2NO — CID 127001204
2,2-difluoro-3-methyl-N-(2-methylprop-2-enyl)cyclopropane-1-carboxamide (PubChem CID 127001204) has the molecular formula C9H13F2NO and a molecular weight of 189.20 g/mol. Its IUPAC name is 2,2-difluoro-3-methyl-N-(2-methylprop-2-enyl)cyclopropane-1-carboxamide.
| Compound Name | 2,2-difluoro-3-methyl-N-(2-methylprop-2-enyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 127001204 |
| Molecular Formula | C9H13F2NO |
| Molecular Weight | 189.20 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2,2-difluoro-3-methyl-N-(2-methylprop-2-enyl)cyclopropane-1-carboxamide |
| SMILES | C=C(C)CNC(=O)C1C(C)C1(F)F |
| InChI | InChI=1S/C9H13F2NO/c1-5(2)4-12-8(13)7-6(3)9(7,10)11/h6-7H,1,4H2,2-3H3,(H,12,13) |
| InChIKey | WFSAAHBCGJSNAY-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.20 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|