C13H20N2O — CID 59957000
[[8-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]methanol (PubChem CID 59957000) has the molecular formula C13H20N2O and a molecular weight of 220.32 g/mol. Its IUPAC name is [[8-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]methanol.
| Compound Name | [[8-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]methanol |
|---|---|
| PubChem CID | 59957000 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | [[8-(2-aminoethyl)-5,6,7,8-tetrahydronaphthalen-2-yl]amino]methanol |
| SMILES | NCCC1CCCc2ccc(NCO)cc21 |
| InChI | InChI=1S/C13H20N2O/c14-7-6-11-3-1-2-10-4-5-12(15-9-16)8-13(10)11/h4-5,8,11,15-16H,1-3,6-7,9,14H2 |
| InChIKey | YRSUNKISQIYZOM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|