C27H24BN2O2 — CID 59957109
CID 59957109 (PubChem CID 59957109) has the molecular formula C27H24BN2O2 and a molecular weight of 419.31 g/mol.
| Compound Name | CID 59957109 |
|---|---|
| PubChem CID | 59957109 |
| Molecular Formula | C27H24BN2O2 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | — |
| SMILES | C[B]ON(c1ccc(N=C(c2ccccc2)c2ccccc2)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C27H24BN2O2/c1-28-32-30(25-17-19-26(31-2)20-18-25)24-15-13-23(14-16-24)29-27(21-9-5-3-6-10-21)22-11-7-4-8-12-22/h3-20H,1-2H3 |
| InChIKey | CBWQXIPEZHZYAW-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|